Citrulline malate is a salt combination of the amino acid citrulline and malic acid. It is recognized as a nutritional ingredient used for its potential anti-fatigue properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 54940-97-5
Citrulline malate
anti-fatigue compound
L-citrulline
nutritional supplementation
L-Homocitrulline
research compound
Psicopyranose
functional sugar
Glycerol trimyristate
Food ingredient from natural oils
Guanosine 5'-monophosphate disodium salt
flavor enhancer food additive
Acesulfame potassium
Artificial sweetener
(2R)-2-amino-5-(carbamoylamino)pentanoic acid
Research compound
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid
DROVUXYZTXCEBX-WCCKRBBISA-N
C(C[C@@H](C(=O)O)N)CNC(=O)N.C(C(C(=O)O)O)C(=O)O