This compound is a brominated methoxynaphthalene derivative commonly used as a research reagent in organic synthesis and laboratory studies. Its structure features an aromatic ring system with a bromine atom and a methoxy group, contributing to its moderate lipophilicity and low polarity.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 54828-63-6
Diethyl Methyl-d3-malonate
Deuterated malonate ester research reagent
6-Chloro-N,N-dimethylnicotinamide
research compound
DL-2,3-Diaminopropionic acid hydrochloride
Proteomics research reagent
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
6-bromo-1-methoxynaphthalene
SKRSSNLRBLWLCE-UHFFFAOYSA-N
COC1=CC=CC2=C1C=CC(=C2)Br