3-Aminophthalic acid is a chemical compound that forms as a product when luminol undergoes oxidation in the presence of a catalyst. It is primarily significant as a reagent used in chemiluminescence assays, including forensic applications where luminol and hydrogen peroxide are employed to detect traces of blood.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5434-20-8
1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride
research compound
5-(2-NITRO-PROPENYL)-BENZO(1,3)DIOXOLE
research compound
Cytidine 5'-diphosphate disodium salt
nucleoside diphosphate research reagent
1-IODOHEXADECANE
Laboratory reagent
Dimethylzinc
organometallic reagent for chemical synthesis
3-aminophthalic acid
WGLQHUKCXBXUDV-UHFFFAOYSA-N
C1=CC(=C(C(=C1)N)C(=O)O)C(=O)O