Ethyl acetylphenylacetate is a chemical compound used as a pharmaceutical intermediate in drug manufacturing. It features an aromatic ring and ester functional groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5413-05-8
Diethyl phenylmalonate
n.a
3-ethoxy-3-oxo-2-phenylpropanoic acid
Pharmaceutical intermediate
Methyl 3-oxo-2-phenylbutanoate
Pharmaceutical intermediate
5-Amino-4,6-dichloropyrimidine
pharmaceutical intermediate
Bis(2-bromoethyl) ether
pharmaceutical intermediate
(8S,13S,14S,17R)-13-Methyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,6,7,8,12,13,14,15,16,17-dodecahydrospiro(cyclopenta(a)phenanthrene-3,2'-(1,3)dioxolan)-17-ol
Pharmaceutical intermediate for steroid synthesis
1-(4-Pyridinyl)pyridinium chloride hydrochloride
pharmaceutical intermediate
ethyl 3-oxo-2-phenylbutanoate
PWRUKIPYVGHRFL-UHFFFAOYSA-N
CCOC(=O)C(C1=CC=CC=C1)C(=O)C