Di-tert-butyl malonate is a chemical compound used primarily as a pharmaceutical intermediate. It serves as a building block in the synthesis of various active pharmaceutical ingredients and research compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 541-16-2
Tert-Butyl methyl malonate
research compound
Tert-butyl acetoacetate
Chemical intermediate
Mono-tert-Butyl malonate
Pharmaceutical intermediate
Tert-Butyl ethyl malonate
Chemical intermediate for organic synthesis
3,3-Dimethylacrylic acid
pharmaceutical intermediate
3-Aminobutanoic acid
peptide building block intermediate
1H-Pyrrole-2,5-dione
Pharmaceutical intermediate and research reagent
(5,6-Dichloropyridin-3-yl)methanol
pharmaceutical intermediate
ditert-butyl propanedioate
CLPHAYNBNTVRDI-UHFFFAOYSA-N
CC(C)(C)OC(=O)CC(=O)OC(C)(C)C