4-Bromo-3-nitrotoluene is a research compound that features a bromine atom and a nitro group on a toluene ring. Its structure is relevant for studying the ortho effect in substituted benzene compounds, a phenomenon that influences chemical properties through steric and polar interactions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5326-34-1
N-(4-methyl-2-pyridyl)acetamide
chemical research intermediate
2-ACETAMIDO-6-METHYLPYRIDINE
research compound
5-Hexynoic acid
terminal acetylenic compound for research
(2R,3R,4S,5R)-2-[6-amino-2-(phenylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol
Research nucleoside analog
1-bromo-4-methyl-2-nitrobenzene
UPBUTKQMDPHQAQ-UHFFFAOYSA-N
CC1=CC(=C(C=C1)Br)[N+](=O)[O-]