This compound is a chemical compound primarily used as an intermediate in pharmaceutical manufacturing. It contains a carbamate group and an ether functional group, contributing to its role in synthetic organic chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 532410-39-2
5-Amino-3-bromo-2-methoxypyridine
Pharmaceutical intermediate for synthesis
2-(2-(4-Chlorophenyl)acetyl)benzoic acid
pharmaceutical intermediate
2-Chloro-4-(methylsulfonyl)benzoic acid
Pharmaceutical intermediate
2-Amino-5-iodobenzoic acid
Pharmaceutical intermediate for drug synthesis
tert-butyl N-methyl-N-(2-oxopropyl)carbamate
UJXOEXQSZFGUSO-UHFFFAOYSA-N
CC(=O)CN(C)C(=O)OC(C)(C)C