Cyanidin chloride is a research reagent and an anthocyanidin compound commonly used as an assay reagent in laboratory studies. It is a salt-like, aromatic, heterocyclic compound with multiple hydroxyl groups, typically investigated for its antioxidant and color-related properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 528-58-5
Cyanidin
plant pigment and antioxidant
Adenosine 5'-monophosphoramidate sodium salt
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol chloride
COAWNPJQKJEHPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-]