This compound is a protected amino acid derivative, specifically the tert-butoxycarbonyl (Boc) protected form of D-tryptophan. It is primarily used as a building block in the synthesis of peptides and other pharmaceutical intermediates.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5241-64-5
Tert-butyl (R)-(1-(1H-indol-3-yl)propan-2-yl)carbamate
research compound
Tert-Butyl ((2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl)carbamate
Pharmaceutical intermediate for peptide synthesis
Boc-Trp(Boc)-OH
Protected amino acid building block
Z-THR(TBU)-OME
Protected amino acid building block
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
2-(naphthalen-1-yl)propanal
Pharmaceutical intermediate or impurity reference
Tetrahydrofuran-2-carbonyl chloride
Pharmaceutical intermediate for synthesis
(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
NFVNYBJCJGKVQK-CYBMUJFWSA-N
CC(C)(C)OC(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)O