t-Boc-aminocaproic-N-hydroxysuccinimide is a chemical compound used as a protected amino acid derivative in peptide synthesis. Its structure includes a tert-butoxycarbonyl (Boc) protecting group and an N-hydroxysuccinimide ester, making it suitable for coupling reactions in laboratory and industrial peptide manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 51513-80-5
1-tert-Butyl 18-(2,5-dioxopyrrolidin-1-yl) octadecanedioate
research compound
1-tert-Butyl 20-(2,5-dioxopyrrolidin-1-yl) icosanedioate
research compound for PEGylation
N-alpha-t-Butyloxycarbonyl-N-alpha-methyl-L-isoleucine
protected amino acid for peptide synthesis
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Boc-D-alanine
protected amino acid for peptide synthesis
Boc-l-lys(ivdde)-oh
protected amino acid for peptide synthesis
H-Ser(tBu)-OtBu HCl
protected serine derivative for peptide synthesis
(R)-(-)-Epichlorohydrin
chiral intermediate for L-carnitine
(2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate
TYJPSIQEEXOQLC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O