Abietinsäure
Abietic acid is a diterpenoid naturally occurring in coniferous trees, where it is believed to play a role in defending the plant against insects and wounds. It is a chiral, tricyclic molecule containing two alkene groups and a carboxylic acid functional group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 514-10-3
1,1'-(Pentane-1,5-diyl)bis(1-methylpyrrolidinium) dibromide
Structure directing agent for zeolites
Sodium benzenesulfonate
Detergent and anionic surfactant
5,6,7,8-tetrahydronaphthalene-2-carbaldehyde
chemical intermediate for synthesis
9,10-Bis(phenylethynyl)-2-methylanthracene
Fluorescent dye and probe
(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
RSWGJHLUYNHPMX-ONCXSQPRSA-N
CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)O)C