1,2-Dibromopropane-d6 is a deuterated form of 1,2-dibromopropane used primarily as a solvent or reference standard in nuclear magnetic resonance spectroscopy. Its structure incorporates six deuterium atoms, providing a stable isotopic label for analytical and research applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 51209-47-3
Neodecaneperoxoic acid, 1,1,3,3-tetramethylbutyl ester
Polymerization initiator for PVC production
(4S)-4-methyl-1,3-dioxolan-2-one
cyclic carbonate solvent
1-Chloro-2-methylpropane
Organochlorine chemical intermediate
METHALLYL ALCOHOL
chemical process industry intermediate
1,2-dibromo-1,1,2,3,3,3-hexadeuteriopropane
XFNJYAKDBJUJAJ-LIDOUZCJSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])Br)Br