Avadharidine is a diterpenoid alkaloid featuring an aconitane skeleton with multiple substituents, including ester and amide groups. It is primarily used as a research compound for studying the structure and properties of aconitane-type diterpenoid alkaloids.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 509-16-0
Ajacine
naturally occurring plant alkaloid
Noradenalone hydrochloride
research compound
5-(2-chlorophenyl)-2H-1,2,3,4-tetrazole
research compound for medicinal chemistry
Tert-butyl 4-(4-nitrobenzoyl)piperazine-1-carboxylate
Research compound
2-Acetamido-5-nitropyridine
research compound
[(1S,2R,3R,4S,5R,6S,8R,9S,13S,16S,17R,18R)-11-ethyl-8,9-dihydroxy-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl]methyl 2-[(4-amino-4-oxobutanoyl)amino]benzoate
ZBALYAJAWGGUCX-OVHFASGNSA-N
CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@H]([C@@](C31)([C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC)OC)O)O)OC)OC)COC(=O)C7=CC=CC=C7NC(=O)CCC(=O)N