This compound is a pharmaceutical intermediate primarily used in the synthesis of various active pharmaceutical ingredients. It features a pyrrolidine ring with a hydroxycarbamimidoyl group and a tert-butyloxycarbonyl protecting group, making it a versatile building block for medicinal chemistry research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 500024-95-3
1,3-Dihydroxyadamantan
pharmaceutical raw material
Cyclobutanecarbonyl chloride
Chemical intermediate for pharmaceutical synthesis
Ethyl nipecotate
Pharmaceutical intermediate for nipecotic acid derivatives
BENZYL CHLOROFORMATE
Peptide synthesis blocking reagent
tert-butyl 2-[(Z)-N'-hydroxycarbamimidoyl]pyrrolidine-1-carboxylate
NUMIITGLIZNJIC-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCCC1/C(=N/O)/N
—