Dipicolinsäure
2,6-Pyridinedicarboxylic acid is a dicarboxylic acid derivative of pyridine, characterized by two carboxylic acid groups at the 2 and 6 positions of the pyridine ring. It is commonly used as a building block in coordination chemistry and as an intermediate in organic synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 499-83-2
pyridine-2,6-dicarboxylic acid
WJJMNDUMQPNECX-UHFFFAOYSA-N
C1=CC(=NC(=C1)C(=O)O)C(=O)O