Scopine is a tropane alkaloid found in plants such as Mandragora root and certain species of Senecio and Scopolia. It is primarily used as a pharmaceutical intermediate.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 498-45-3
Scopine hydrochloride
pharmaceutical intermediate
Isonipecotic acid
pharmaceutical intermediate
2-Azabicyclo[2.2.1]hept-5-en-3-one
Pharmaceutical intermediate for abacavir synthesis
Mercaptopurine disulfide
Pharmaceutical intermediate for thiopurine derivatives
1-phenethylimidazole
antifungal intermediate
(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol
FIMXSEMBHGTNKT-UPGAHCIJSA-N
CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)O