This compound is a boronic acid derivative of an indole, featuring a tert-butyloxycarbonyl (Boc) protecting group and a bromine substituent. It is primarily used as a pharmaceutical intermediate in chemical synthesis, facilitating the construction of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 475102-13-7
Methyl 2-chloroacetoacetate
Pharmaceutical intermediate for synthesis
1-boc-3-cyanopyrrolidine
pharmaceutical intermediate
5-BROMO-2-IODO-3-METHOXYPYRAZINE
Pharmaceutical intermediate
Boc-Tyr(2-Br-Z)-OH
Protected amino acid for peptide synthesis
[5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid
RBYTXZMVOGZESQ-UHFFFAOYSA-N
B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br)(O)O