Dichloramine B is an This compound compound used primarily as a disinfectant and antiseptic agent.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 473-29-0
Chloramine-T trihydrate
Disinfectant and antiseptic agent
Iodine
Disinfectant and antiseptic agent
Capitol Records
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
N-Methyl-o-phenylenediamine
chemical intermediate for dyes and pigments
2,2-Bis(hydroxymethyl)propionic acid
Biodegradable polymer and coating intermediate
N,N-dichlorobenzenesulfonamide
PJBJJXCZRAHMCK-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N(Cl)Cl