Pyridine-2,6-dicarboxamide is a research compound featuring a pyridine ring with two amide functional groups. Its relatively high polarity and moderate molecular weight make it suitable for laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4663-97-2
(4-methylpyridin-3-yl)methanol
Research reagent
L-Leucinamide, L-phenylalanyl-L-alanyl-L-lysyl-L-alanyl-L-leucyl-L-lysyl-L-alanyl-L-leucyl-L-leucyl-L-lysyl-L-alanyl-L-leucyl-L-lysyl-L-alanyl-
research peptide compound
Tetradecylphosphonic acid
phosphonic acid research compound
Norscopolamine
certified reference standard
pyridine-2,6-dicarboxamide
UUVCRNTVNKTNRK-UHFFFAOYSA-N
C1=CC(=NC(=C1)C(=O)N)C(=O)N