4-(Trifluoromethyl)benzoic acid is an organic compound featuring a carboxylic acid group attached to a benzene ring that carries a trifluoromethyl substituent. It is commonly used as a research reagent in synthetic chemistry and materials science.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 455-24-3
3,5-Difluorobenzoic acid
Research reagent
4-Amino-3-fluorobenzoic acid
research compound
4-hydroxypyridine-d5
deuterated research reagent
LITHIUM-P-STYRENESULFONATE
Ion exchange monomer research
Sodium 4-(trifluoromethyl)benzoate
research compound
4-(trifluoromethyl)benzoic acid
SWKPKONEIZGROQ-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)C(F)(F)F