This compound is a pharmaceutical intermediate, specifically an acyl chloride derivative of an isoxazole ring. It is primarily used as a building block in the synthesis of other chemical compounds for research and manufacturing purposes.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4462-55-9
3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for floxacrine analogues
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for drug synthesis
2-[(2R)-2-Hydroxy-3-[[4-(3-oxo-4-morpholinyl)phenyl]amino]propyl]-1H-isoindole-1,3(2H)-dione
rivaroxaban intermediate
2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione
intermediate for rivaroxaban synthesis
(S)-4-(4-(5-(AMINOMETHYL)-2-OXOOXAZOLIDIN-3-YL)PHENYL)MORPHOLIN-3-ONE
Rivaroxaban intermediate
Boronic acid, (6-(benzoylmethylamino)-5-methyl-3-pyridinyl)-
Pharmaceutical intermediate
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
IZQGELJKDARDMZ-UHFFFAOYSA-N
CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl