4-Fluoro-3-propylbenzoic acid is a fluorinated benzoic acid derivative used as a research compound. Its structure features a carboxylic acid group, an aromatic ring, and a fluorine atom, contributing to its properties as a laboratory reagent.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 445018-80-4
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Boronic ester for Suzuki coupling
1,4-Dihydro-1,4-methanonaphthalene
research compound
3-(difluoromethyl)-4-fluoroaniline
research compound
Nicotinamide Riboside Triflate
Research compound for NAD+ metabolism
4-fluoro-3-propylbenzoic acid
CWGCZLDQVNFBMO-UHFFFAOYSA-N
CCCC1=C(C=CC(=C1)C(=O)O)F