4-Bromo-2-(trifluoromethyl)aniline is an aromatic amine compound containing a bromine atom and a trifluoromethyl group on the benzene ring. It is primarily used as a chemical intermediate in organic synthesis and pharmaceutical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 445-02-3
4-bromo-2-(trifluoromethyl)aniline
PHXGKHTWEOPCEW-UHFFFAOYSA-N
C1=CC(=C(C=C1Br)C(F)(F)F)N