(Bis-carboxymethyl-amino)-malonic acid is a research compound featuring multiple carboxylic acid groups and an amine functional group. It is primarily used as a laboratory reagent for chemical synthesis and investigative studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4379-32-2
2-tert-butylpropanedioic acid
research compound
4-(2-Pyridyl)benzoic acid
research compound
4-(4-pyridyl)benzoic acid
research compound
3-(Pyridin-3-yl)benzoic acid
research compound
2-(dicarboxymethylamino)propanedioic acid
SPCFZTYBPBQLHK-UHFFFAOYSA-N
C(C(=O)O)(C(=O)O)NC(C(=O)O)C(=O)O
—