Decafluorobiphenyl is a highly fluorinated biphenyl derivative widely employed as a research intermediate in organic synthesis. Its perfluorinated aromatic rings contribute to unique chemical stability and physical properties, making it valuable in the development of advanced fluorinated materials and building blocks.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 434-90-2
(Oxybis(2,1-phenylene))bis(dicyclohexylphosphine)
ligand for transition metal catalysis
5-Formyl-2-thiopheneboronic acid
research reagent
3-Bromo-5-(trifluoromethyl)pyridine
chemical research intermediate
5-fluorothiophene-2-carboxylic acid
Research compound
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene
ONUFSRWQCKNVSL-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F