N-tert-butoxycarbonyl-sarcosine methyl ester is a pharmaceutical intermediate used in research and chemical manufacturing. It features ester and ether functional groups and is commonly employed in peptide chemistry as a protected amino acid derivative.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 42492-57-9
5-chlorothiophene-2-carbonyl chloride
pharmaceutical intermediate for sertraline synthesis
(3S)-3-Aminopiperidin-2-one--hydrogen chloride (1/1)
pharmaceutical intermediate
(S)-(+)-1,2-Propanediol
Pharmaceutical intermediate and solvent
Methyl 4-methyl-3-oxopentanoate
pharmaceutical intermediate
methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate
LTBDTYJYKRLTRN-UHFFFAOYSA-N
CC(C)(C)OC(=O)N(C)CC(=O)OC