Perflubron is a perfluorocarbon-based haloalkane, specifically a bromine-substituted perfluorooctane, that serves as both a contrast agent for medical imaging and a synthetic blood substitute. Its key significance lies in its ability to carry oxygen and provide radioopacity, making it useful in diverse medical applications such as retinal detachment surgery and cell culture oxygen supply.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 423-55-2
1,2,3,4-Tetramethylcyclopentadiene
precursor for cyclopentadienyl ligands
Methyltriacetoxysilane
cross-linker for silicone sealants and adhesives
4,4-Dimethylcyclohexanone
chemical research intermediate
1,3,5-Triazine, 2-(2-(4-methoxyphenyl)ethenyl)-4,6-bis(trichloromethyl)-
Photoinitiator for UV-curable coatings
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane
WTWWXOGTJWMJHI-UHFFFAOYSA-N
C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F