Bis(4-allyloxyphenyl)sulfone is a sulfone compound containing two allyloxyphenyl groups connected through a sulfonyl bridge. It is primarily used as a monomer in the synthesis of specialty polymers due to its reactive allyl ether groups and rigid aromatic core.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 41481-63-4
Irganox 1035
antioxidant for polymers and lubricants
Tris(4-isocyanatophenyl) thiophosphate
polyurethane crosslinking agent
1-Bromo-4-chloro-2-nitrobenzene
Industrial intermediate for synthesis
3-Chlorobenzylamine
Chemical intermediate for synthesis
Phenol, 4,4'-sulfonylbis[2-(2-propenyl)-
sulfonic acid derivative
Puerto Rico Highway 2
flame retardant additive
2,4'-Dihydroxydiphenyl sulfone
sulfone monomer for polymer synthesis
3,3'-Dinitrodiphenyl sulfone
production of 3,3-diamino diphenyl sulfone
1-prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonylbenzene
JUNVYDTYJZSTKY-UHFFFAOYSA-N
C=CCOC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)OCC=C