1-(Phenylsulfonyl)-1H-indole is a sulfonamide compound used as a pharmaceutical intermediate in chemical synthesis. It features an indole ring bonded to a phenylsulfonyl group, contributing to its role in building more complex molecules for pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 40899-71-6
Methyl 4-acetamido-5-chloro-2-methoxybenzoate
Pharmaceutical intermediate
Ethyl 5-acetyloxy-1,2-dimethylindole-3-carboxylate
Pharmaceutical intermediate
4-Aminopiperidine-4-carboxylic acid
Pharmaceutical intermediate for CELMoD synthesis
N-Methyl-2,2'-diaminodiethylamine
Pharmaceutical intermediate
1-(phenylsulfonyl)-1H-indol-3-ylboronic acid
boronic acid building block
1-(benzenesulfonyl)indole
VDWLCYCWLIKWBV-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC=CC=C32