This compound is a protected lysine derivative featuring two benzyloxycarbonyl (Cbz) protecting groups on the amino functions. It is primarily used as a building block in solid-phase peptide synthesis, allowing the selective incorporation of lysine residues with orthogonal protection.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 405-39-0
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine
protected amino acid for peptide synthesis
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
Z-Lys(Fmoc)-OH
Protected lysine derivative for peptide synthesis
Chloromethyl Methyl Carbonate
chemical intermediate for pharmaceuticals
(R)-4-N-Cbz-piperazine-2-carboxylic acid methyl ester
Pharmaceutical intermediate
(1R,3R)-3-aminocyclohexanol
pharmaceutical intermediate
6-methyl-4-phenyl-3,4-dihydrochromen-2-one
Pharmaceutical intermediate
(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoic acid
BLZXFNUZFTZCFD-IBGZPJMESA-N
C1=CC=C(C=C1)COC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2