2-Fluoro-4-nitrobenzoic acid is an organic compound featuring both a carboxylic acid and a nitro group on a fluorinated aromatic ring. It is primarily used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 403-24-7
2-Fluoro-5-nitrobenzoic acid
Pharmaceutical intermediate for synthesis
Methyl 4-fluorobenzoate
Pharmaceutical intermediate
4-Fluorobenzoyl chloride
precursor to high-performance polymer PEEK
6-Fluoronicotinic acid
pharmaceutical intermediate
3-Fluorobenzonitrile
Pharmaceutical intermediate
2-fluoro-4-nitrobenzoic acid
MMWFMFZFCKADEL-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)O