Trideuteriomethoxybenzene is a deuterated research standard, where the methoxy group contains three deuterium atoms. It is used as a labeled compound in analytical chemistry and mass spectrometry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4019-63-0
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-(Trifluoromethyl)benzyl bromide
research compound
5-Methyl-1H-pyrazole-3-carboxylic acid
research compound
6-Fluoropyridine-2-carboxylic acid
Research compound
Anisol
solvent and heat transfer medium
trideuteriomethoxybenzene
RDOXTESZEPMUJZ-FIBGUPNXSA-N
[2H]C([2H])([2H])OC1=CC=CC=C1