This compound is a deuterated fatty acid used primarily as a research reagent. Its fully deuterated structure makes it suitable for tracer studies and analytical chemistry applications where isotopic labeling is required.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 39756-32-6
Dodecanoic-d23 acid
isotopically labeled research reference standard
Undecanoic acid-d21
deuterated fatty acid research reagent
Tetradecanoic-d27 acid
Deuterated fatty acid standard
Hexadecanoic-d31 acid
Deuterated reference standard for fatty acid analysis
2-Propanol-1,1,1,3,3,3-d6
Deuterated internal standard for NMR
2-amino-6-methylpyrimidin-4-one
biochemical precursor to thiamine pyrophosphate
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
6-phenylpyridin-2-amine
research compound
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-nonatriacontadeuterioicosanoic acid
VKOBVWXKNCXXDE-BKDZISOFSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O