(S)-2-Benzylsuccinic acid is a chiral dicarboxylic acid used as an intermediate in the manufacture of ACE inhibitor pharmaceuticals. Its structure features a benzyl group and two carboxylic acid functions, contributing to its role in the synthesis of compounds that regulate blood pressure.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 3972-36-9
1-Phenethyl-4-piperidone
Pharmaceutical intermediate for fentanyl synthesis
2-Hydroxy-6-methyl-3-nitropyridine
pharmaceutical intermediate
3-Amino-2-chloro-6-picoline
pharmaceutical intermediate
Corey Lactone Aldehyde Benzoate
Prostaglandin intermediate
(2S)-2-benzylbutanedioic acid
GTOFKXZQQDSVFH-VIFPVBQESA-N
C1=CC=C(C=C1)C[C@@H](CC(=O)O)C(=O)O