4-Fluoro-2-nitrobenzoic acid is a fluorinated aromatic carboxylic acid used primarily as a building block in pharmaceutical manufacturing. Its structure combines a carboxylic acid group with a nitro group and a fluorine atom on a benzene ring, making it a valuable intermediate for synthesizing more complex drug compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 394-01-4
5-Fluoro-2-methoxybenzoic acid
Aurora A kinase inhibitor intermediate
2-Bromo-5-fluorobenzoic acid
pharmaceutical intermediate
5'-Fluoro-2'-hydroxyacetophenone
Pharmaceutical intermediate
Methyl 2-fluorobenzoate
dye, pesticide, pharmaceutical intermediates
4-fluoro-2-nitrobenzoic acid
YLUCXHMYRQUERW-UHFFFAOYSA-N
C1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)O