This compound is a fluorescent dye characterized by a xanthene core structure with diethylamino substituents and a methyl ester group. It is commonly used as a fluorescent label or tracer due to its bright emission properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 39393-39-0
3,6-Bis(diethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium tetrachlorozincate
Fluorescent solvent dye
3,6-Bis(diethylamino)-9-(2-(ethoxycarbonyl)phenyl)xanthylium chloride
Basic violet pigment
RHODAMINE B
Dye for paper and textiles
Rhodamine B Lake
purple pigment for coloring
Dimethyl 5-sulfoisophthalate sodium salt
sulfonate monomer for polyester dye
4,4'-BIS(2-(2-METHOXYPHENYL)ETHENYL)-1,1'-BIPHENYL
Fluorescent brightener
(1,1'-Bianthracene)-9,9',10,10'-tetrone, 4,4'-diamino-
anthraquinone pigment red 177
4-Chloro-1,8-naphthalic anhydride
Fluorescent solvent dye intermediate
[6-(diethylamino)-9-(2-methoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium chloride
WODAOEIFNMQKIS-UHFFFAOYSA-M
CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)OC.[Cl-]