5-(Piperidin-4-yl)-1H-indole is a research compound featuring a piperidine ring attached to an indole core. Its structure includes an amine group and two aromatic rings, making it of interest for laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 383861-22-1
PC (brain, bovine)
research reagent for lipid studies
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
D-Pipercolic acid HCl
research compound
Cy-vBRIDP
phosphine ligand for homogeneous catalysis
5-piperidin-4-yl-1H-indole
ULMINHJMQWBDGD-UHFFFAOYSA-N
C1CNCCC1C2=CC3=C(C=C2)NC=C3