This compound is a deuterated derivative of naphthalene, specifically labeled with deuterium atoms at multiple positions including a trideuteriomethyl group. It is primarily used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 38072-94-5
Cyclopentanone-2,2,5,5-d4
Deuterated NMR reference standard
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
Deuterated NMR reference standard
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
Diethylaminosulfur trifluoride
fluorinating reagent for organofluorine synthesis
Diethyl ((4-(3-fluorophenyl)-2-pyridyl)methyl) phosphonate
research compound
Phenylzinc bromide
organometallic reagent for cross-coupling
1-METHYLNAPHTHALENE
Solvent and chemical intermediate
1,2,3,4,5,6,7-heptadeuterio-8-(trideuteriomethyl)naphthalene
QPUYECUOLPXSFR-UZHHFJDZSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H]