4-Phenoxyphthalic acid is a chemical compound used as a pharmaceutical intermediate. It features two carboxylic acid groups and an ether-linked aromatic ring, contributing to its role in organic synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 37951-15-8
2-acetyl-4-phenoxy-benzoic acid
research compound
3-(Trifluoromethyl)pyridine
Pharmaceutical intermediate
4-Oxoretinoic acid
retinoid metabolite intermediate
(4-Boc-Aminophenyl)Boronic Acid
Boc-protected aminophenylboronic acid intermediate
(3-BOC-AMINOPHENYL)BORONIC ACID
Pharmaceutical intermediate
4-phenoxyphthalic acid
FKDITAXSGNKBOZ-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC(=C(C=C2)C(=O)O)C(=O)O