Perfluorobutanesulfonyl fluoride is a perfluorinated organic compound featuring a sulfonyl fluoride group. It serves as an intermediate in the synthesis of perfluorinated sulfonyl fluoride derivatives.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 375-72-4
Perfluoroheptanoic acid
Non-polymer PFAS industrial intermediate
3,6-Di-tert-butylcarbazole
electronic material intermediate
4,4-bis(methoxymethyl)biphenyl
chemical intermediate
Diethyl perfluoroadipate
Fluorinated chemical intermediate
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl fluoride
LUYQYZLEHLTPBH-UHFFFAOYSA-N
C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F