2-(Methoxycarbonyl)benzeneboronic acid is a boronic acid derivative used primarily as a research reagent in organic synthesis. It functions as a coupling partner in Suzuki cross-coupling reactions, enabling the formation of carbon-carbon bonds in complex molecular structures.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 374538-03-1
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
4-tert-Butoxyphenylboronic acid
Suzuki coupling reagent
Pyridine-2-boronic acid, pinacol ester
Suzuki coupling reagent
Nbi 31772
insulin-like growth factor binding protein inhibitor
2-chloro-3-fluoro-6-methylpyridine
research compound
6-Bromo-3-fluoro-2-methylpyridine
Pharmaceutical research compound
Kisspeptin-10 (human)
research peptide for GPR54 ligand studies
(2-methoxycarbonylphenyl)boronic acid
ODAXNYMENLFYMY-UHFFFAOYSA-N
B(C1=CC=CC=C1C(=O)OC)(O)O