Arginine ethyl ester hydrochloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients. It is the hydrochloride salt form of L-arginine ethyl ester, a derivative of the amino acid arginine.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 36589-29-4
Cis-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine
Pharmaceutical intermediate for chiral synthesis
Ethyl (1S,3R,4R)-3-{[(tert-butoxy)carbonyl]amino}-4-hydroxycyclohexane-1-carboxylate
Pharmaceutical intermediate for drug synthesis
1,1-Dimethylethyl N-[(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexyl]carbamate
Pharmaceutical intermediate for edoxaban synthesis
3-Fluoro-4-methoxyaniline
pharmaceutical intermediate
ethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;hydrochloride
DUCUWLZKZPQJDY-RGMNGODLSA-N
CCOC(=O)[C@H](CCCN=C(N)N)N.Cl