2,4,6-Trimethylphenol-d11 is a deuterated analytical reference standard used primarily in research and analytical chemistry for quantitative analysis and method development. Its structure includes a phenolic ring with three trideuteriomethyl groups and deuterium atoms at specific positions, ensuring high isotopic purity for reliable tracing in mass spectrometry and other analytical techniques.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 362049-45-4
2,3,5-TRIMETHYLPHENOL-D11
Deuterated research reagent
Methyl Paraben-d4
deuterated internal standard for analysis
D-Phenylalanine-d5
deuterated amino acid research reagent
1,3-Dioxolan-2-one-d4
deuterated research compound
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)phenol
BPRYUXCVCCNUFE-JXCHDVSKSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]