CYCLO(-ASP-ASP) is a cyclic dipeptide consisting of two aspartic acid residues linked in a cyclic structure. This compound is typically used as a research reagent in biochemical and pharmaceutical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 35309-53-6
(R)-(-)-2-Amino-1-propanol
Research compound and synthetic intermediate
(+)-Epicatechin
research compound
2-chloro-3-nitropyridine-4-carboxylic acid
building block for pharmaceutical synthesis
(R)-2-Azido-2-phenylacetyl chloride
Research reagent
CYCLO(-SER-SER)
research compound
Piperazine-2,5-dione
research compound
Cyclo(-Ala-Glu)
research compound
2-[(2S,5S)-5-(carboxymethyl)-3,6-dioxopiperazin-2-yl]acetic acid
NMAZZUSURHBTKP-IMJSIDKUSA-N
C([C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O)C(=O)O