Tropine 3-mesylate is a research compound with the molecular formula C9H17NO3S and a mesylate functional group attached to the tropine scaffold.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 35130-97-3
(1R,2R)-(+)-1,2-Diphenylethylenediamine
chiral ligand for asymmetric catalysis
Bis(1,5-cyclooctadiene)rhodium(I) tetrafluoroborate
organometallic catalyst for organic synthesis
Bis(1,5-cyclooctadiene)iridium(I) tetrafluoroborate
organometallic catalyst precursor
(3-(Pyridin-3-yl)phenyl)boronic acid
research compound
Nortropine
research compound
Endo-8-Methyl-8-azabicyclo[3.2.1]octan-3-amine
research compound
Tropine-3-thiol HCl
pharmaceutical intermediate
(-)-Ecgonine-d3 Hydrochloride
pharmaceutical reference standard
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate
JDDPSVBBPCQWAL-JVHMLUBASA-N
CN1[C@@H]2CC[C@H]1CC(C2)OS(=O)(=O)C