Trichloro(N,N-dimethylbenzylamine)boron is a research compound featuring a boron atom coordinated with three chlorine atoms and a dimethylbenzylamine group, forming an inner salt structure. It is primarily used as a laboratory reagent for chemical synthesis and research applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 34762-89-5
Hydroxydehydro Nifedipine Carboxylate
research compound
3-bromoisoquinoline
research compound
5-Bromisochinolin
research compound
3-Chloro-2,4,6-trideuteroaniline
deuterated research compound
[benzyl(dimethyl)azaniumyl]-trichloroboranuide
LKMHSFZIOPQRLU-UHFFFAOYSA-N
[B-]([N+](C)(C)CC1=CC=CC=C1)(Cl)(Cl)Cl
—