N-Benzoxycarbonyl-L-proline succinimido ester is a protected amino acid derivative used as a coupling reagent in peptide synthesis. Its structure contains a succinimidyl ester group that facilitates amide bond formation while the benzyloxycarbonyl (Cbz) group protects the amino function.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 3397-33-9
N-Phthaloyl-L-glutamic acid
pharmaceutical intermediate for Lenacapavir
2-Bromo-1,1-diethoxypropane
Pharmaceutical intermediate
N-Benzoyl-2'-O-(2-methoxyethyl)-5-methylcytidine
Pharmaceutical intermediate for nucleoside analogs
5-(4-chlorophenyl)-2-furaldehyde
pharmaceutical intermediate
1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-pyrrolidine-1,2-dicarboxylate
BDNYCEKWUBRCBJ-ZDUSSCGKSA-N
C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)ON3C(=O)CCC3=O