This compound is a potassium salt of a phosphate ester, commonly utilized as a laboratory reagent in chemical research and synthesis. Its structure features a phosphate group with two tert-butyl substituents and a potassium counterion, conferring specific solubility and reactivity properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 33494-80-3
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
Norleual
research compound
(2S)-2-[(2-Methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid
Isotopically labeled amino acid derivative
SZCKQRFZBSIRLK-UHFFFAOYSA-N
CC(C)(C)OP(=O)(O)OC(C)(C)C.[K]
—