This compound is a pyrimidine-based ester featuring a substituted benzylamino group, commonly utilized as an intermediate in pharmaceutical synthesis. Its structure includes an aromatic amine, an ester, and ether functionalities, contributing to its role in building more complex molecular architectures.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 330785-81-4
4-[[(3-Chloro-4-methoxyphenyl)methyl]amino]-2-[(2S)-2-(hydroxymethyl)-1-pyrrolidinyl]-5-pyrimidinecarboxylic acid
Pharmaceutical intermediate
3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Ibrutinib intermediate
2-[hydroxy-(4-phenoxyphenyl)methylene]propanedinitrile
pharmaceutical intermediate or impurity
3-Amino-5-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile
Pharmaceutical intermediate for kinase inhibitors
ethyl 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylate
WLOQDGSMJNYRRC-UHFFFAOYSA-N
CCOC(=O)C1=CN=C(N=C1NCC2=CC(=C(C=C2)OC)Cl)SC