This compound is a benzimidazole derivative used primarily as a research compound. Its structure includes an amide and an amine functional group, contributing to its properties as a laboratory reagent.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 328543-09-5
Benzeneacetic acid, 4-(trifluoromethyl)-
research compound
Benzylamine hydrochloride
pharmaceutical research intermediate
Diphenyl[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine oxide
research compound
(4-(2-(Azepan-1-yl)ethoxy)phenyl)methanol hydrochloride
Research compound
2-[4-[(dimethylamino)methyl]phenyl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one
SEKJSSBJKFLZIT-UHFFFAOYSA-N
CN(C)CC1=CC=C(C=C1)C2=NC3=CC=CC4=C3N2CCNC4=O